- #1
Shay10825
- 338
- 0
Hello. Can someone please check my work and help me with these problems. I'm sorry it is so long.
Predict and balance the following organic equation.
--------------------------------------------------------
1. Ethanol (ethyl alcohol) is burned completely in air
C2H5OH + 3O2 > 2CO2 + 3H2O
--------------------------------------------------------
2. Propane gas is heated with chlorine gas
C3H8 + Cl2 > C3H7Cl + HCl
--------------------------------------------------------
3. Ethanol (ethyl alcohol) and methanoic acid (formic acid) are mixed and warmed
C2H5OH + CH3OH > CO2 + H2O
If this is correct then how do I balance it?
--------------------------------------------------------
4. Ethene gas is bubbled through a solution of bromine
C2H4 + Br2 > C2H4Br2
--------------------------------------------------------
5. Hydrogen gas is added to 2-pentene
H2 + C5H10 > C5H12
--------------------------------------------------------
6. Octane is burned in oxygen
2C8H18 + 25 O2 > 16CO2 + 18H2O
--------------------------------------------------------
7. 2-butene is combined with hydrogen gas in the presence of a nickel catalyst
C4H10 + H2 +Ni > ?
--------------------------------------------------------
8. Ethanoic acid is combined with propanol
C2H5OH + C3H7OH > CO2 + H2O
If this is correct then how do I balance it?
--------------------------------------------------------
9. An excess of chlorine gas is added to pure ethyne (acetylene) gas
Cl2 + C2H2 > C2H2Cl2
--------------------------------------------------------
10. A limited amount of liquid bromine is added to an excess of benzene (C6H6)
Br2 + C6H6 > C6H4Br2 + H2
--------------------------------------------------------
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
Name the following hydrocarbon compounds.
1. (CH3)2CHCl
dimethyl?? How do I name it with the Cl ??
--------------------------------------------------------
2. CH3C(CH3)2CH2C(CH3)2CH2CH2CH3
2,4 dimethylheptane
--------------------------------------------------------
3. CH3C(CH3)2CH - - C(CH3)CH2CH3
2,4 dimethylpentane
--------------------------------------------------------
4. CH3C --- CCH3
1,2 dimethylethane
--------------------------------------------------------
Thanks
Predict and balance the following organic equation.
--------------------------------------------------------
1. Ethanol (ethyl alcohol) is burned completely in air
C2H5OH + 3O2 > 2CO2 + 3H2O
--------------------------------------------------------
2. Propane gas is heated with chlorine gas
C3H8 + Cl2 > C3H7Cl + HCl
--------------------------------------------------------
3. Ethanol (ethyl alcohol) and methanoic acid (formic acid) are mixed and warmed
C2H5OH + CH3OH > CO2 + H2O
If this is correct then how do I balance it?
--------------------------------------------------------
4. Ethene gas is bubbled through a solution of bromine
C2H4 + Br2 > C2H4Br2
--------------------------------------------------------
5. Hydrogen gas is added to 2-pentene
H2 + C5H10 > C5H12
--------------------------------------------------------
6. Octane is burned in oxygen
2C8H18 + 25 O2 > 16CO2 + 18H2O
--------------------------------------------------------
7. 2-butene is combined with hydrogen gas in the presence of a nickel catalyst
C4H10 + H2 +Ni > ?
--------------------------------------------------------
8. Ethanoic acid is combined with propanol
C2H5OH + C3H7OH > CO2 + H2O
If this is correct then how do I balance it?
--------------------------------------------------------
9. An excess of chlorine gas is added to pure ethyne (acetylene) gas
Cl2 + C2H2 > C2H2Cl2
--------------------------------------------------------
10. A limited amount of liquid bromine is added to an excess of benzene (C6H6)
Br2 + C6H6 > C6H4Br2 + H2
--------------------------------------------------------
~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
Name the following hydrocarbon compounds.
1. (CH3)2CHCl
dimethyl?? How do I name it with the Cl ??
--------------------------------------------------------
2. CH3C(CH3)2CH2C(CH3)2CH2CH2CH3
2,4 dimethylheptane
--------------------------------------------------------
3. CH3C(CH3)2CH - - C(CH3)CH2CH3
2,4 dimethylpentane
--------------------------------------------------------
4. CH3C --- CCH3
1,2 dimethylethane
--------------------------------------------------------
Thanks